C40H34O12 — CID 59583954
[6-[(E)-3-[6-(prop-2-enoyloxymethoxy)naphthalen-2-yl]prop-2-enoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (E)-3-[6-(prop-2-enoyloxymethoxy)naphthalen-2-yl]prop-2-enoate (PubChem CID 59583954) has the molecular formula C40H34O12 and a molecular weight of 706.70 g/mol. Its IUPAC name is [6-[(E)-3-[6-(prop-2-enoyloxymethoxy)naphthalen-2-yl]prop-2-enoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (E)-3-[6-(prop-2-enoyloxymethoxy)naphthalen-2-yl]prop-2-enoate.
| Compound Name | [6-[(E)-3-[6-(prop-2-enoyloxymethoxy)naphthalen-2-yl]prop-2-enoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (E)-3-[6-(prop-2-enoyloxymethoxy)naphthalen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 59583954 |
| Molecular Formula | C40H34O12 |
| Molecular Weight | 706.70 g/mol |
| Exact Mass | 706.21 |
| IUPAC Name | [6-[(E)-3-[6-(prop-2-enoyloxymethoxy)naphthalen-2-yl]prop-2-enoyl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] (E)-3-[6-(prop-2-enoyloxymethoxy)naphthalen-2-yl]prop-2-enoate |
| SMILES | C=CC(=O)OCOc1ccc2cc(/C=C/C(=O)OC3COC4C(OC(=O)/C=C/c5ccc6cc(OCOC(=O)C=C)ccc6c5)COC34)ccc2c1 |
| InChI | InChI=1S/C40H34O12/c1-3-35(41)49-23-47-31-13-11-27-17-25(5-9-29(27)19-31)7-15-37(43)51-33-21-45-40-34(22-46-39(33)40)52-38(44)16-8-26-6-10-30-20-32(14-12-28(30)18-26)48-24-50-36(42)4-2/h3-20,33-34,39-40H,1-2,21-24H2/b15-7+,16-8+ |
| InChIKey | AKBKETJMURDZCP-BGPOSVGRSA-N |
| XLogP | 5.47 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.70 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|