C33H26F2O10 — CID 21036056
[3-(difluoromethyl)-4-[(E)-3-[4-(prop-2-enoyloxymethoxy)phenyl]prop-2-enoyl]oxyphenyl] (E)-3-[4-(prop-2-enoyloxymethoxy)phenyl]prop-2-enoate (PubChem CID 21036056) has the molecular formula C33H26F2O10 and a molecular weight of 620.56 g/mol. Its IUPAC name is [3-(difluoromethyl)-4-[(E)-3-[4-(prop-2-enoyloxymethoxy)phenyl]prop-2-enoyl]oxyphenyl] (E)-3-[4-(prop-2-enoyloxymethoxy)phenyl]prop-2-enoate.
| Compound Name | [3-(difluoromethyl)-4-[(E)-3-[4-(prop-2-enoyloxymethoxy)phenyl]prop-2-enoyl]oxyphenyl] (E)-3-[4-(prop-2-enoyloxymethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 21036056 |
| Molecular Formula | C33H26F2O10 |
| Molecular Weight | 620.56 g/mol |
| Exact Mass | 620.15 |
| IUPAC Name | [3-(difluoromethyl)-4-[(E)-3-[4-(prop-2-enoyloxymethoxy)phenyl]prop-2-enoyl]oxyphenyl] (E)-3-[4-(prop-2-enoyloxymethoxy)phenyl]prop-2-enoate |
| SMILES | C=CC(=O)OCOc1ccc(/C=C/C(=O)Oc2ccc(OC(=O)/C=C/c3ccc(OCOC(=O)C=C)cc3)c(C(F)F)c2)cc1 |
| InChI | InChI=1S/C33H26F2O10/c1-3-29(36)42-20-40-24-11-5-22(6-12-24)9-17-31(38)44-26-15-16-28(27(19-26)33(34)35)45-32(39)18-10-23-7-13-25(14-8-23)41-21-43-30(37)4-2/h3-19,33H,1-2,20-21H2/b17-9+,18-10+ |
| InChIKey | PZDDQMFBOBYDSB-BEQMOXJMSA-N |
| XLogP | 5.99 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|