C40H39NO10 — CID 58444516
[2-methyl-4-[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]oxyphenyl] (Z)-2-isocyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate (PubChem CID 58444516) has the molecular formula C40H39NO10 and a molecular weight of 693.75 g/mol. Its IUPAC name is [2-methyl-4-[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]oxyphenyl] (Z)-2-isocyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate.
| Compound Name | [2-methyl-4-[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]oxyphenyl] (Z)-2-isocyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58444516 |
| Molecular Formula | C40H39NO10 |
| Molecular Weight | 693.75 g/mol |
| Exact Mass | 693.26 |
| IUPAC Name | [2-methyl-4-[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]oxyphenyl] (Z)-2-isocyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate |
| SMILES | [C-]#[N+]/C(=C\c1ccc(OCCCCOC(=O)C=C)cc1)C(=O)Oc1ccc(OC(=O)/C=C/c2ccc(OCCCCOC(=O)C=C)cc2)cc1C |
| InChI | InChI=1S/C40H39NO10/c1-5-37(42)48-25-9-7-23-46-32-16-11-30(12-17-32)15-22-39(44)50-34-20-21-36(29(3)27-34)51-40(45)35(41-4)28-31-13-18-33(19-14-31)47-24-8-10-26-49-38(43)6-2/h5-6,11-22,27-28H,1-2,7-10,23-26H2,3H3/b22-15+,35-28- |
| InChIKey | SXWOSSKMVJDCOU-RILDVDNSSA-N |
| XLogP | 7.26 |
| TPSA | 128.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.75 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|