C40H44O9 — CID 154620091
[3-methyl-4-[(E)-3-[4-[4-(2-methylprop-2-enoyloxy)butoxy]phenyl]prop-2-enoyl]oxyphenyl] 4-[4-(3-methylbuta-1,3-dien-2-yloxy)butoxy]benzoate (PubChem CID 154620091) has the molecular formula C40H44O9 and a molecular weight of 668.78 g/mol. Its IUPAC name is [3-methyl-4-[(E)-3-[4-[4-(2-methylprop-2-enoyloxy)butoxy]phenyl]prop-2-enoyl]oxyphenyl] 4-[4-(3-methylbuta-1,3-dien-2-yloxy)butoxy]benzoate.
| Compound Name | [3-methyl-4-[(E)-3-[4-[4-(2-methylprop-2-enoyloxy)butoxy]phenyl]prop-2-enoyl]oxyphenyl] 4-[4-(3-methylbuta-1,3-dien-2-yloxy)butoxy]benzoate |
|---|---|
| PubChem CID | 154620091 |
| Molecular Formula | C40H44O9 |
| Molecular Weight | 668.78 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | [3-methyl-4-[(E)-3-[4-[4-(2-methylprop-2-enoyloxy)butoxy]phenyl]prop-2-enoyl]oxyphenyl] 4-[4-(3-methylbuta-1,3-dien-2-yloxy)butoxy]benzoate |
| SMILES | C=C(C)C(=C)OCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)/C=C/c3ccc(OCCCCOC(=O)C(=C)C)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C40H44O9/c1-28(2)31(6)44-23-7-8-24-46-35-18-14-33(15-19-35)40(43)48-36-20-21-37(30(5)27-36)49-38(41)22-13-32-11-16-34(17-12-32)45-25-9-10-26-47-39(42)29(3)4/h11-22,27H,1,3,6-10,23-26H2,2,4-5H3/b22-13+ |
| InChIKey | UTNPHYVEVDKPCQ-LPYMAVHISA-N |
| XLogP | 8.38 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.78 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|