C49H46O9 — CID 167105695
[4-[(E)-3-[4-[4-[3-cyclopropyl-4-(6-formyloxyhexoxy)phenyl]phenyl]phenyl]prop-2-enoyl]oxy-3-methylphenyl] 4-(2-methylprop-2-enoyloxy)benzoate (PubChem CID 167105695) has the molecular formula C49H46O9 and a molecular weight of 778.90 g/mol. Its IUPAC name is [4-[(E)-3-[4-[4-[3-cyclopropyl-4-(6-formyloxyhexoxy)phenyl]phenyl]phenyl]prop-2-enoyl]oxy-3-methylphenyl] 4-(2-methylprop-2-enoyloxy)benzoate.
| Compound Name | [4-[(E)-3-[4-[4-[3-cyclopropyl-4-(6-formyloxyhexoxy)phenyl]phenyl]phenyl]prop-2-enoyl]oxy-3-methylphenyl] 4-(2-methylprop-2-enoyloxy)benzoate |
|---|---|
| PubChem CID | 167105695 |
| Molecular Formula | C49H46O9 |
| Molecular Weight | 778.90 g/mol |
| Exact Mass | 778.31 |
| IUPAC Name | [4-[(E)-3-[4-[4-[3-cyclopropyl-4-(6-formyloxyhexoxy)phenyl]phenyl]phenyl]prop-2-enoyl]oxy-3-methylphenyl] 4-(2-methylprop-2-enoyloxy)benzoate |
| SMILES | C=C(C)C(=O)Oc1ccc(C(=O)Oc2ccc(OC(=O)/C=C/c3ccc(-c4ccc(-c5ccc(OCCCCCCOC=O)c(C6CC6)c5)cc4)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C49H46O9/c1-33(2)48(52)56-42-22-19-40(20-23-42)49(53)57-43-24-26-45(34(3)30-43)58-47(51)27-10-35-8-11-36(12-9-35)37-13-15-38(16-14-37)41-21-25-46(44(31-41)39-17-18-39)55-29-7-5-4-6-28-54-32-50/h8-16,19-27,30-32,39H,1,4-7,17-18,28-29H2,2-3H3/b27-10+ |
| InChIKey | ZIECILIIMDVYLH-YPXUMCKCSA-N |
| XLogP | 10.64 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.90 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|