C42H48O9 — CID 89384925
(3-methyl-4-prop-2-enoyloxybutyl) 4-[4-[(E)-3-[3-methyl-4-(8-prop-2-enoyloxyoctoxy)phenyl]prop-2-enoyl]oxyphenyl]benzoate (PubChem CID 89384925) has the molecular formula C42H48O9 and a molecular weight of 696.84 g/mol. Its IUPAC name is (3-methyl-4-prop-2-enoyloxybutyl) 4-[4-[(E)-3-[3-methyl-4-(8-prop-2-enoyloxyoctoxy)phenyl]prop-2-enoyl]oxyphenyl]benzoate.
| Compound Name | (3-methyl-4-prop-2-enoyloxybutyl) 4-[4-[(E)-3-[3-methyl-4-(8-prop-2-enoyloxyoctoxy)phenyl]prop-2-enoyl]oxyphenyl]benzoate |
|---|---|
| PubChem CID | 89384925 |
| Molecular Formula | C42H48O9 |
| Molecular Weight | 696.84 g/mol |
| Exact Mass | 696.33 |
| IUPAC Name | (3-methyl-4-prop-2-enoyloxybutyl) 4-[4-[(E)-3-[3-methyl-4-(8-prop-2-enoyloxyoctoxy)phenyl]prop-2-enoyl]oxyphenyl]benzoate |
| SMILES | C=CC(=O)OCCCCCCCCOc1ccc(/C=C/C(=O)Oc2ccc(-c3ccc(C(=O)OCCC(C)COC(=O)C=C)cc3)cc2)cc1C |
| InChI | InChI=1S/C42H48O9/c1-5-39(43)48-27-12-10-8-7-9-11-26-47-38-23-13-33(29-32(38)4)14-24-41(45)51-37-21-19-35(20-22-37)34-15-17-36(18-16-34)42(46)49-28-25-31(3)30-50-40(44)6-2/h5-6,13-24,29,31H,1-2,7-12,25-28,30H2,3-4H3/b24-14+ |
| InChIKey | KPHVGBDGTHLPKO-ZVHZXABRSA-N |
| XLogP | 8.64 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.84 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|