C40H36N2O10 — CID 58444513
[4-[(Z)-2-isocyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]oxyphenyl] (E)-2-cyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate (PubChem CID 58444513) has the molecular formula C40H36N2O10 and a molecular weight of 704.73 g/mol. Its IUPAC name is [4-[(Z)-2-isocyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]oxyphenyl] (E)-2-cyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate.
| Compound Name | [4-[(Z)-2-isocyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]oxyphenyl] (E)-2-cyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58444513 |
| Molecular Formula | C40H36N2O10 |
| Molecular Weight | 704.73 g/mol |
| Exact Mass | 704.24 |
| IUPAC Name | [4-[(Z)-2-isocyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]oxyphenyl] (E)-2-cyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate |
| SMILES | [C-]#[N+]/C(=C\c1ccc(OCCCCOC(=O)C=C)cc1)C(=O)Oc1ccc(OC(=O)/C(C#N)=C/c2ccc(OCCCCOC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C40H36N2O10/c1-4-37(43)49-24-8-6-22-47-32-14-10-29(11-15-32)26-31(28-41)39(45)51-34-18-20-35(21-19-34)52-40(46)36(42-3)27-30-12-16-33(17-13-30)48-23-7-9-25-50-38(44)5-2/h4-5,10-21,26-27H,1-2,6-9,22-25H2/b31-26+,36-27- |
| InChIKey | PNRUFITZSNSHGY-SCJUXTSHSA-N |
| XLogP | 6.84 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.73 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|