C38H34N2O10S — CID 88902137
[5-[(E)-2-cyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]sulfanylfuran-2-yl] (E)-2-cyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate (PubChem CID 88902137) has the molecular formula C38H34N2O10S and a molecular weight of 710.76 g/mol. Its IUPAC name is [5-[(E)-2-cyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]sulfanylfuran-2-yl] (E)-2-cyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate.
| Compound Name | [5-[(E)-2-cyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]sulfanylfuran-2-yl] (E)-2-cyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 88902137 |
| Molecular Formula | C38H34N2O10S |
| Molecular Weight | 710.76 g/mol |
| Exact Mass | 710.19 |
| IUPAC Name | [5-[(E)-2-cyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]sulfanylfuran-2-yl] (E)-2-cyano-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(/C=C(\C#N)C(=O)Oc2ccc(SC(=O)/C(C#N)=C/c3ccc(OCCCCOC(=O)C=C)cc3)o2)cc1 |
| InChI | InChI=1S/C38H34N2O10S/c1-3-33(41)47-21-7-5-19-45-31-13-9-27(10-14-31)23-29(25-39)37(43)50-35-17-18-36(49-35)51-38(44)30(26-40)24-28-11-15-32(16-12-28)46-20-6-8-22-48-34(42)4-2/h3-4,9-18,23-24H,1-2,5-8,19-22H2/b29-23+,30-24+ |
| InChIKey | UGNOIFDRSHNXNO-HCTXVGCHSA-N |
| XLogP | 6.79 |
| TPSA | 175.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.76 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|