C36H36O10S — CID 58444485
[5-[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]sulfanylfuran-2-yl] (E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate (PubChem CID 58444485) has the molecular formula C36H36O10S and a molecular weight of 660.74 g/mol. Its IUPAC name is [5-[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]sulfanylfuran-2-yl] (E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate.
| Compound Name | [5-[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]sulfanylfuran-2-yl] (E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58444485 |
| Molecular Formula | C36H36O10S |
| Molecular Weight | 660.74 g/mol |
| Exact Mass | 660.20 |
| IUPAC Name | [5-[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]sulfanylfuran-2-yl] (E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(/C=C/C(=O)Oc2ccc(SC(=O)/C=C/c3ccc(OCCCCOC(=O)C=C)cc3)o2)cc1 |
| InChI | InChI=1S/C36H36O10S/c1-3-31(37)43-25-7-5-23-41-29-15-9-27(10-16-29)13-19-33(39)45-35-21-22-36(46-35)47-34(40)20-14-28-11-17-30(18-12-28)42-24-6-8-26-44-32(38)4-2/h3-4,9-22H,1-2,5-8,23-26H2/b19-13+,20-14+ |
| InChIKey | DXWHODLZUZVAMZ-IWGRKNQJSA-N |
| XLogP | 7.01 |
| TPSA | 127.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.74 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|