C24H22O6S — CID 155241809
3-[4-[(E)-3-(4-prop-2-enoyloxyphenyl)prop-2-enoyl]sulfanylphenoxy]propyl prop-2-enoate (PubChem CID 155241809) has the molecular formula C24H22O6S and a molecular weight of 438.50 g/mol. Its IUPAC name is 3-[4-[(E)-3-(4-prop-2-enoyloxyphenyl)prop-2-enoyl]sulfanylphenoxy]propyl prop-2-enoate.
| Compound Name | 3-[4-[(E)-3-(4-prop-2-enoyloxyphenyl)prop-2-enoyl]sulfanylphenoxy]propyl prop-2-enoate |
|---|---|
| PubChem CID | 155241809 |
| Molecular Formula | C24H22O6S |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 3-[4-[(E)-3-(4-prop-2-enoyloxyphenyl)prop-2-enoyl]sulfanylphenoxy]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCOc1ccc(SC(=O)/C=C/c2ccc(OC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C24H22O6S/c1-3-22(25)29-17-5-16-28-19-11-13-21(14-12-19)31-24(27)15-8-18-6-9-20(10-7-18)30-23(26)4-2/h3-4,6-15H,1-2,5,16-17H2/b15-8+ |
| InChIKey | YNANEMSQZNGUMP-OVCLIPMQSA-N |
| XLogP | 4.61 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|