C37H39NO8S — CID 123840228
4-[4-[3-[3-methoxy-4-[[4-(4-prop-2-enoyloxybutoxy)phenyl]methylideneamino]phenyl]sulfanyl-3-oxoprop-1-enyl]phenoxy]butyl prop-2-enoate (PubChem CID 123840228) has the molecular formula C37H39NO8S and a molecular weight of 657.79 g/mol. Its IUPAC name is 4-[4-[3-[3-methoxy-4-[[4-(4-prop-2-enoyloxybutoxy)phenyl]methylideneamino]phenyl]sulfanyl-3-oxoprop-1-enyl]phenoxy]butyl prop-2-enoate.
| Compound Name | 4-[4-[3-[3-methoxy-4-[[4-(4-prop-2-enoyloxybutoxy)phenyl]methylideneamino]phenyl]sulfanyl-3-oxoprop-1-enyl]phenoxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 123840228 |
| Molecular Formula | C37H39NO8S |
| Molecular Weight | 657.79 g/mol |
| Exact Mass | 657.24 |
| IUPAC Name | 4-[4-[3-[3-methoxy-4-[[4-(4-prop-2-enoyloxybutoxy)phenyl]methylideneamino]phenyl]sulfanyl-3-oxoprop-1-enyl]phenoxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C=CC(=O)Sc2ccc(/N=C/c3ccc(OCCCCOC(=O)C=C)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C37H39NO8S/c1-4-35(39)45-24-8-6-22-43-30-15-10-28(11-16-30)14-21-37(41)47-32-19-20-33(34(26-32)42-3)38-27-29-12-17-31(18-13-29)44-23-7-9-25-46-36(40)5-2/h4-5,10-21,26-27H,1-2,6-9,22-25H2,3H3/b21-14?,38-27+ |
| InChIKey | SDGMSOGYTALMHJ-ZYXLEZIWSA-N |
| XLogP | 7.55 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.79 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|