C33H34N2O7 — CID 168764606
[3-methyl-4-[[4-(4-prop-2-enoyloxybutoxy)phenyl]methylideneamino]phenyl] (E)-3-(3-acetamido-4-methoxyphenyl)prop-2-enoate (PubChem CID 168764606) has the molecular formula C33H34N2O7 and a molecular weight of 570.64 g/mol. Its IUPAC name is [3-methyl-4-[[4-(4-prop-2-enoyloxybutoxy)phenyl]methylideneamino]phenyl] (E)-3-(3-acetamido-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [3-methyl-4-[[4-(4-prop-2-enoyloxybutoxy)phenyl]methylideneamino]phenyl] (E)-3-(3-acetamido-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 168764606 |
| Molecular Formula | C33H34N2O7 |
| Molecular Weight | 570.64 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | [3-methyl-4-[[4-(4-prop-2-enoyloxybutoxy)phenyl]methylideneamino]phenyl] (E)-3-(3-acetamido-4-methoxyphenyl)prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(/C=N/c2ccc(OC(=O)/C=C/c3ccc(OC)c(NC(C)=O)c3)cc2C)cc1 |
| InChI | InChI=1S/C33H34N2O7/c1-5-32(37)41-19-7-6-18-40-27-12-8-26(9-13-27)22-34-29-15-14-28(20-23(29)2)42-33(38)17-11-25-10-16-31(39-4)30(21-25)35-24(3)36/h5,8-17,20-22H,1,6-7,18-19H2,2-4H3,(H,35,36)/b17-11+,34-22+ |
| InChIKey | VPXODRSVFCOIAE-XCUDELCGSA-N |
| XLogP | 6.22 |
| TPSA | 112.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.64 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|