C44H48O8 — CID 20730935
methyl (E)-3-[3-methoxy-4-[6-[4-[2-[6-(6-prop-2-enoyloxyhexoxy)naphthalen-2-yl]ethynyl]phenoxy]hexoxy]phenyl]prop-2-enoate (PubChem CID 20730935) has the molecular formula C44H48O8 and a molecular weight of 704.86 g/mol. Its IUPAC name is methyl (E)-3-[3-methoxy-4-[6-[4-[2-[6-(6-prop-2-enoyloxyhexoxy)naphthalen-2-yl]ethynyl]phenoxy]hexoxy]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-methoxy-4-[6-[4-[2-[6-(6-prop-2-enoyloxyhexoxy)naphthalen-2-yl]ethynyl]phenoxy]hexoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 20730935 |
| Molecular Formula | C44H48O8 |
| Molecular Weight | 704.86 g/mol |
| Exact Mass | 704.33 |
| IUPAC Name | methyl (E)-3-[3-methoxy-4-[6-[4-[2-[6-(6-prop-2-enoyloxyhexoxy)naphthalen-2-yl]ethynyl]phenoxy]hexoxy]phenyl]prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc2cc(C#Cc3ccc(OCCCCCCOc4ccc(/C=C/C(=O)OC)cc4OC)cc3)ccc2c1 |
| InChI | InChI=1S/C44H48O8/c1-4-43(45)52-30-12-8-6-10-28-50-40-24-21-37-31-35(15-20-38(37)33-40)14-13-34-16-22-39(23-17-34)49-27-9-5-7-11-29-51-41-25-18-36(32-42(41)47-2)19-26-44(46)48-3/h4,15-26,31-33H,1,5-12,27-30H2,2-3H3/b26-19+ |
| InChIKey | UXMYWKMKSWQGBZ-LGUFXXKBSA-N |
| XLogP | 9.12 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.86 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|