C44H48O8 — CID 69107224
methyl (E)-3-[3-methoxy-4-[6-[4-[2-[6-(1-prop-2-enoyloxyhexoxy)naphthalen-2-yl]ethynyl]phenoxy]hexoxy]phenyl]prop-2-enoate (PubChem CID 69107224) has the molecular formula C44H48O8 and a molecular weight of 704.86 g/mol. Its IUPAC name is methyl (E)-3-[3-methoxy-4-[6-[4-[2-[6-(1-prop-2-enoyloxyhexoxy)naphthalen-2-yl]ethynyl]phenoxy]hexoxy]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-methoxy-4-[6-[4-[2-[6-(1-prop-2-enoyloxyhexoxy)naphthalen-2-yl]ethynyl]phenoxy]hexoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 69107224 |
| Molecular Formula | C44H48O8 |
| Molecular Weight | 704.86 g/mol |
| Exact Mass | 704.33 |
| IUPAC Name | methyl (E)-3-[3-methoxy-4-[6-[4-[2-[6-(1-prop-2-enoyloxyhexoxy)naphthalen-2-yl]ethynyl]phenoxy]hexoxy]phenyl]prop-2-enoate |
| SMILES | C=CC(=O)OC(CCCCC)Oc1ccc2cc(C#Cc3ccc(OCCCCCCOc4ccc(/C=C/C(=O)OC)cc4OC)cc3)ccc2c1 |
| InChI | InChI=1S/C44H48O8/c1-5-7-10-13-44(52-42(45)6-2)51-39-25-22-36-30-34(16-21-37(36)32-39)15-14-33-17-23-38(24-18-33)49-28-11-8-9-12-29-50-40-26-19-35(31-41(40)47-3)20-27-43(46)48-4/h6,16-27,30-32,44H,2,5,7-13,28-29H2,1,3-4H3/b27-20+ |
| InChIKey | PWMSFEHEPJIUQM-NHFJDJAPSA-N |
| XLogP | 9.47 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.86 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|