C45H59BrO10 — CID 69041083
methyl (E)-3-[4-[8-[3-(bromomethyl)-5-[8-[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]octoxy]phenoxy]octoxy]-3-methoxyphenyl]prop-2-enoate (PubChem CID 69041083) has the molecular formula C45H59BrO10 and a molecular weight of 839.86 g/mol. Its IUPAC name is methyl (E)-3-[4-[8-[3-(bromomethyl)-5-[8-[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]octoxy]phenoxy]octoxy]-3-methoxyphenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[8-[3-(bromomethyl)-5-[8-[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]octoxy]phenoxy]octoxy]-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 69041083 |
| Molecular Formula | C45H59BrO10 |
| Molecular Weight | 839.86 g/mol |
| Exact Mass | 838.33 |
| IUPAC Name | methyl (E)-3-[4-[8-[3-(bromomethyl)-5-[8-[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]octoxy]phenoxy]octoxy]-3-methoxyphenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(OCCCCCCCCOc2cc(CBr)cc(OCCCCCCCCOc3ccc(/C=C/C(=O)OC)cc3OC)c2)c(OC)c1 |
| InChI | InChI=1S/C45H59BrO10/c1-49-42-31-35(19-23-44(47)51-3)17-21-40(42)55-27-15-11-7-5-9-13-25-53-38-29-37(34-46)30-39(33-38)54-26-14-10-6-8-12-16-28-56-41-22-18-36(32-43(41)50-2)20-24-45(48)52-4/h17-24,29-33H,5-16,25-28,34H2,1-4H3/b23-19+,24-20+ |
| InChIKey | IUYGNRPXHWBJQC-BLVCXSLXSA-N |
| XLogP | 10.57 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.86 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|