C45H81NO10 — CID 177487724
methyl (E)-3-[4-[2-[bis[2-[2-(2-decoxyethoxy)ethoxy]ethyl]amino]ethoxy]-3-methoxyphenyl]prop-2-enoate (PubChem CID 177487724) has the molecular formula C45H81NO10 and a molecular weight of 796.14 g/mol. Its IUPAC name is methyl (E)-3-[4-[2-[bis[2-[2-(2-decoxyethoxy)ethoxy]ethyl]amino]ethoxy]-3-methoxyphenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[2-[bis[2-[2-(2-decoxyethoxy)ethoxy]ethyl]amino]ethoxy]-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 177487724 |
| Molecular Formula | C45H81NO10 |
| Molecular Weight | 796.14 g/mol |
| Exact Mass | 795.59 |
| IUPAC Name | methyl (E)-3-[4-[2-[bis[2-[2-(2-decoxyethoxy)ethoxy]ethyl]amino]ethoxy]-3-methoxyphenyl]prop-2-enoate |
| SMILES | CCCCCCCCCCOCCOCCOCCN(CCOCCOCCOCCCCCCCCCC)CCOc1ccc(/C=C/C(=O)OC)cc1OC |
| InChI | InChI=1S/C45H81NO10/c1-5-7-9-11-13-15-17-19-28-50-33-37-54-39-35-52-30-25-46(27-32-56-43-23-21-42(41-44(43)48-3)22-24-45(47)49-4)26-31-53-36-40-55-38-34-51-29-20-18-16-14-12-10-8-6-2/h21-24,41H,5-20,25-40H2,1-4H3/b24-22+ |
| InChIKey | CRMMPDHOJLIWMZ-ZNTNEXAZSA-N |
| XLogP | 8.94 |
| TPSA | 103.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.14 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|