C19H26O4 — CID 67981109
methyl 3-[4-(1-prop-1-en-2-yloxyhexoxy)phenyl]prop-2-enoate (PubChem CID 67981109) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is methyl 3-[4-(1-prop-1-en-2-yloxyhexoxy)phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-(1-prop-1-en-2-yloxyhexoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 67981109 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | methyl 3-[4-(1-prop-1-en-2-yloxyhexoxy)phenyl]prop-2-enoate |
| SMILES | C=C(C)OC(CCCCC)Oc1ccc(C=CC(=O)OC)cc1 |
| InChI | InChI=1S/C19H26O4/c1-5-6-7-8-19(22-15(2)3)23-17-12-9-16(10-13-17)11-14-18(20)21-4/h9-14,19H,2,5-8H2,1,3-4H3 |
| InChIKey | PQRXSDYYFSPNDE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|