C40H41NO10 — CID 20615344
[3-acetyl-4-[[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]amino]phenyl] (E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate (PubChem CID 20615344) has the molecular formula C40H41NO10 and a molecular weight of 695.76 g/mol. Its IUPAC name is [3-acetyl-4-[[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]amino]phenyl] (E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate.
| Compound Name | [3-acetyl-4-[[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]amino]phenyl] (E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 20615344 |
| Molecular Formula | C40H41NO10 |
| Molecular Weight | 695.76 g/mol |
| Exact Mass | 695.27 |
| IUPAC Name | [3-acetyl-4-[[(E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]amino]phenyl] (E)-3-[4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(/C=C/C(=O)Nc2ccc(OC(=O)/C=C/c3ccc(OCCCCOC(=O)C=C)cc3)cc2C(C)=O)cc1 |
| InChI | InChI=1S/C40H41NO10/c1-4-38(44)49-26-8-6-24-47-32-16-10-30(11-17-32)14-22-37(43)41-36-21-20-34(28-35(36)29(3)42)51-40(46)23-15-31-12-18-33(19-13-31)48-25-7-9-27-50-39(45)5-2/h4-5,10-23,28H,1-2,6-9,24-27H2,3H3,(H,41,43)/b22-14+,23-15+ |
| InChIKey | MPEKSZFDIOTBDP-HOFJZWJUSA-N |
| XLogP | 6.94 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.76 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|