C36H37NO10 — CID 22976457
[3-acetyl-4-[[4-(4-prop-2-enoyloxybutoxy)benzoyl]amino]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate (PubChem CID 22976457) has the molecular formula C36H37NO10 and a molecular weight of 643.69 g/mol. Its IUPAC name is [3-acetyl-4-[[4-(4-prop-2-enoyloxybutoxy)benzoyl]amino]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate.
| Compound Name | [3-acetyl-4-[[4-(4-prop-2-enoyloxybutoxy)benzoyl]amino]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
|---|---|
| PubChem CID | 22976457 |
| Molecular Formula | C36H37NO10 |
| Molecular Weight | 643.69 g/mol |
| Exact Mass | 643.24 |
| IUPAC Name | [3-acetyl-4-[[4-(4-prop-2-enoyloxybutoxy)benzoyl]amino]phenyl] 4-(4-prop-2-enoyloxybutoxy)benzoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C(=O)Nc2ccc(OC(=O)c3ccc(OCCCCOC(=O)C=C)cc3)cc2C(C)=O)cc1 |
| InChI | InChI=1S/C36H37NO10/c1-4-33(39)45-22-8-6-20-43-28-14-10-26(11-15-28)35(41)37-32-19-18-30(24-31(32)25(3)38)47-36(42)27-12-16-29(17-13-27)44-21-7-9-23-46-34(40)5-2/h4-5,10-19,24H,1-2,6-9,20-23H2,3H3,(H,37,41) |
| InChIKey | PFXNGMCXIYGXJT-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.69 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|