C30H28N2O6 — CID 76628892
ethyl 3-[4-[2-[4-[bis(2-prop-2-enoyloxyethyl)amino]phenyl]ethynyl]phenyl]-2-cyanoprop-2-enoate (PubChem CID 76628892) has the molecular formula C30H28N2O6 and a molecular weight of 512.56 g/mol. Its IUPAC name is ethyl 3-[4-[2-[4-[bis(2-prop-2-enoyloxyethyl)amino]phenyl]ethynyl]phenyl]-2-cyanoprop-2-enoate.
| Compound Name | ethyl 3-[4-[2-[4-[bis(2-prop-2-enoyloxyethyl)amino]phenyl]ethynyl]phenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 76628892 |
| Molecular Formula | C30H28N2O6 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | ethyl 3-[4-[2-[4-[bis(2-prop-2-enoyloxyethyl)amino]phenyl]ethynyl]phenyl]-2-cyanoprop-2-enoate |
| SMILES | C=CC(=O)OCCN(CCOC(=O)C=C)c1ccc(C#Cc2ccc(C=C(C#N)C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C30H28N2O6/c1-4-28(33)37-19-17-32(18-20-38-29(34)5-2)27-15-13-24(14-16-27)8-7-23-9-11-25(12-10-23)21-26(22-31)30(35)36-6-3/h4-5,9-16,21H,1-2,6,17-20H2,3H3 |
| InChIKey | OYMFBYCXIKHPPO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 105.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|