C35H44N4O4 — CID 71260623
2-[(E)-2-cyano-3-[4-(dipropylamino)phenyl]prop-2-enoyl]oxypropyl (E)-2-cyano-3-[4-(dipropylamino)phenyl]prop-2-enoate (PubChem CID 71260623) has the molecular formula C35H44N4O4 and a molecular weight of 584.76 g/mol. Its IUPAC name is 2-[(E)-2-cyano-3-[4-(dipropylamino)phenyl]prop-2-enoyl]oxypropyl (E)-2-cyano-3-[4-(dipropylamino)phenyl]prop-2-enoate.
| Compound Name | 2-[(E)-2-cyano-3-[4-(dipropylamino)phenyl]prop-2-enoyl]oxypropyl (E)-2-cyano-3-[4-(dipropylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 71260623 |
| Molecular Formula | C35H44N4O4 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | 2-[(E)-2-cyano-3-[4-(dipropylamino)phenyl]prop-2-enoyl]oxypropyl (E)-2-cyano-3-[4-(dipropylamino)phenyl]prop-2-enoate |
| SMILES | CCCN(CCC)c1ccc(/C=C(\C#N)C(=O)OCC(C)OC(=O)/C(C#N)=C/c2ccc(N(CCC)CCC)cc2)cc1 |
| InChI | InChI=1S/C35H44N4O4/c1-6-18-38(19-7-2)32-14-10-28(11-15-32)22-30(24-36)34(40)42-26-27(5)43-35(41)31(25-37)23-29-12-16-33(17-13-29)39(20-8-3)21-9-4/h10-17,22-23,27H,6-9,18-21,26H2,1-5H3/b30-22+,31-23+ |
| InChIKey | YWYAKYYWFQQPJP-WECXDZCISA-N |
| XLogP | 6.93 |
| TPSA | 106.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|