C33H28F4O10 — CID 21036055
[3-(difluoromethyl)-4-[3-[3-fluoro-4-(prop-2-enoyloxymethoxy)phenyl]propanoyloxy]phenyl] 3-[3-fluoro-4-(prop-2-enoyloxymethoxy)phenyl]propanoate (PubChem CID 21036055) has the molecular formula C33H28F4O10 and a molecular weight of 660.57 g/mol. Its IUPAC name is [3-(difluoromethyl)-4-[3-[3-fluoro-4-(prop-2-enoyloxymethoxy)phenyl]propanoyloxy]phenyl] 3-[3-fluoro-4-(prop-2-enoyloxymethoxy)phenyl]propanoate.
| Compound Name | [3-(difluoromethyl)-4-[3-[3-fluoro-4-(prop-2-enoyloxymethoxy)phenyl]propanoyloxy]phenyl] 3-[3-fluoro-4-(prop-2-enoyloxymethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 21036055 |
| Molecular Formula | C33H28F4O10 |
| Molecular Weight | 660.57 g/mol |
| Exact Mass | 660.16 |
| IUPAC Name | [3-(difluoromethyl)-4-[3-[3-fluoro-4-(prop-2-enoyloxymethoxy)phenyl]propanoyloxy]phenyl] 3-[3-fluoro-4-(prop-2-enoyloxymethoxy)phenyl]propanoate |
| SMILES | C=CC(=O)OCOc1ccc(CCC(=O)Oc2ccc(OC(=O)CCc3ccc(OCOC(=O)C=C)c(F)c3)c(C(F)F)c2)cc1F |
| InChI | InChI=1S/C33H28F4O10/c1-3-29(38)44-18-42-27-10-5-20(15-24(27)34)7-13-31(40)46-22-9-12-26(23(17-22)33(36)37)47-32(41)14-8-21-6-11-28(25(35)16-21)43-19-45-30(39)4-2/h3-6,9-12,15-17,33H,1-2,7-8,13-14,18-19H2 |
| InChIKey | WCXZCOJNQPLMSS-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|