C31H28F4O8 — CID 21036029
[3-(difluoromethyl)-4-[3-[3-fluoro-4-(oxiran-2-ylmethoxy)phenyl]propanoyloxy]phenyl] 3-[3-fluoro-4-(oxiran-2-ylmethoxy)phenyl]propanoate (PubChem CID 21036029) has the molecular formula C31H28F4O8 and a molecular weight of 604.55 g/mol. Its IUPAC name is [3-(difluoromethyl)-4-[3-[3-fluoro-4-(oxiran-2-ylmethoxy)phenyl]propanoyloxy]phenyl] 3-[3-fluoro-4-(oxiran-2-ylmethoxy)phenyl]propanoate.
| Compound Name | [3-(difluoromethyl)-4-[3-[3-fluoro-4-(oxiran-2-ylmethoxy)phenyl]propanoyloxy]phenyl] 3-[3-fluoro-4-(oxiran-2-ylmethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 21036029 |
| Molecular Formula | C31H28F4O8 |
| Molecular Weight | 604.55 g/mol |
| Exact Mass | 604.17 |
| IUPAC Name | [3-(difluoromethyl)-4-[3-[3-fluoro-4-(oxiran-2-ylmethoxy)phenyl]propanoyloxy]phenyl] 3-[3-fluoro-4-(oxiran-2-ylmethoxy)phenyl]propanoate |
| SMILES | O=C(CCc1ccc(OCC2CO2)c(F)c1)Oc1ccc(OC(=O)CCc2ccc(OCC3CO3)c(F)c2)c(C(F)F)c1 |
| InChI | InChI=1S/C31H28F4O8/c32-24-11-18(1-6-27(24)40-16-21-14-38-21)3-9-29(36)42-20-5-8-26(23(13-20)31(34)35)43-30(37)10-4-19-2-7-28(25(33)12-19)41-17-22-15-39-22/h1-2,5-8,11-13,21-22,31H,3-4,9-10,14-17H2 |
| InChIKey | HKYYCADJQFLWLX-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|