C31H32F2O9 — CID 21036042
[3-(difluoromethyl)-4-[[4-(oxiran-2-ylmethoxy)phenoxy]methoxy]phenyl] 4-[(3-ethyloxetan-3-yl)methoxymethoxy]benzoate (PubChem CID 21036042) has the molecular formula C31H32F2O9 and a molecular weight of 586.58 g/mol. Its IUPAC name is [3-(difluoromethyl)-4-[[4-(oxiran-2-ylmethoxy)phenoxy]methoxy]phenyl] 4-[(3-ethyloxetan-3-yl)methoxymethoxy]benzoate.
| Compound Name | [3-(difluoromethyl)-4-[[4-(oxiran-2-ylmethoxy)phenoxy]methoxy]phenyl] 4-[(3-ethyloxetan-3-yl)methoxymethoxy]benzoate |
|---|---|
| PubChem CID | 21036042 |
| Molecular Formula | C31H32F2O9 |
| Molecular Weight | 586.58 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | [3-(difluoromethyl)-4-[[4-(oxiran-2-ylmethoxy)phenoxy]methoxy]phenyl] 4-[(3-ethyloxetan-3-yl)methoxymethoxy]benzoate |
| SMILES | CCC1(COCOc2ccc(C(=O)Oc3ccc(OCOc4ccc(OCC5CO5)cc4)c(C(F)F)c3)cc2)COC1 |
| InChI | InChI=1S/C31H32F2O9/c1-2-31(16-35-17-31)18-36-19-39-23-5-3-21(4-6-23)30(34)42-25-11-12-28(27(13-25)29(32)33)41-20-40-24-9-7-22(8-10-24)37-14-26-15-38-26/h3-13,26,29H,2,14-20H2,1H3 |
| InChIKey | FNAPWLPXKPOQNP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 94.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|