C28H27BrO10 — CID 59791149
[3-bromo-4-[[4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]phenyl] 4-(oxiran-2-ylmethoxymethoxy)benzoate (PubChem CID 59791149) has the molecular formula C28H27BrO10 and a molecular weight of 603.42 g/mol. Its IUPAC name is [3-bromo-4-[[4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]phenyl] 4-(oxiran-2-ylmethoxymethoxy)benzoate.
| Compound Name | [3-bromo-4-[[4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]phenyl] 4-(oxiran-2-ylmethoxymethoxy)benzoate |
|---|---|
| PubChem CID | 59791149 |
| Molecular Formula | C28H27BrO10 |
| Molecular Weight | 603.42 g/mol |
| Exact Mass | 602.08 |
| IUPAC Name | [3-bromo-4-[[4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]phenyl] 4-(oxiran-2-ylmethoxymethoxy)benzoate |
| SMILES | O=C(Oc1ccc(OCOc2ccc(OCOCC3CO3)cc2)c(Br)c1)c1ccc(OCOCC2CO2)cc1 |
| InChI | InChI=1S/C28H27BrO10/c29-26-11-23(39-28(30)19-1-3-20(4-2-19)35-16-31-12-24-14-33-24)9-10-27(26)38-18-37-22-7-5-21(6-8-22)36-17-32-13-25-15-34-25/h1-11,24-25H,12-18H2 |
| InChIKey | GBQKRGOPKMGXDY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 106.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|