C27H27FO8 — CID 59790799
2-[[4-[3-fluoro-4-[[4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]phenyl]phenoxy]methoxymethyl]oxirane (PubChem CID 59790799) has the molecular formula C27H27FO8 and a molecular weight of 498.50 g/mol. Its IUPAC name is 2-[[4-[3-fluoro-4-[[4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]phenyl]phenoxy]methoxymethyl]oxirane.
| Compound Name | 2-[[4-[3-fluoro-4-[[4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]phenyl]phenoxy]methoxymethyl]oxirane |
|---|---|
| PubChem CID | 59790799 |
| Molecular Formula | C27H27FO8 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 2-[[4-[3-fluoro-4-[[4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]phenyl]phenoxy]methoxymethyl]oxirane |
| SMILES | Fc1cc(-c2ccc(OCOCC3CO3)cc2)ccc1OCOc1ccc(OCOCC2CO2)cc1 |
| InChI | InChI=1S/C27H27FO8/c28-26-11-20(19-1-4-21(5-2-19)33-16-29-12-24-14-31-24)3-10-27(26)36-18-35-23-8-6-22(7-9-23)34-17-30-13-25-15-32-25/h1-11,24-25H,12-18H2 |
| InChIKey | CYAINYIOUYSQQM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 80.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|