C28H25FO6 — CID 59790608
2-[[4-[4-[2-[2-fluoro-4-(oxiran-2-ylmethoxymethoxy)phenyl]ethynyl]phenyl]phenoxy]methoxymethyl]oxirane (PubChem CID 59790608) has the molecular formula C28H25FO6 and a molecular weight of 476.50 g/mol. Its IUPAC name is 2-[[4-[4-[2-[2-fluoro-4-(oxiran-2-ylmethoxymethoxy)phenyl]ethynyl]phenyl]phenoxy]methoxymethyl]oxirane.
| Compound Name | 2-[[4-[4-[2-[2-fluoro-4-(oxiran-2-ylmethoxymethoxy)phenyl]ethynyl]phenyl]phenoxy]methoxymethyl]oxirane |
|---|---|
| PubChem CID | 59790608 |
| Molecular Formula | C28H25FO6 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-[[4-[4-[2-[2-fluoro-4-(oxiran-2-ylmethoxymethoxy)phenyl]ethynyl]phenyl]phenoxy]methoxymethyl]oxirane |
| SMILES | Fc1cc(OCOCC2CO2)ccc1C#Cc1ccc(-c2ccc(OCOCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C28H25FO6/c29-28-13-25(35-19-31-15-27-17-33-27)12-9-23(28)6-3-20-1-4-21(5-2-20)22-7-10-24(11-8-22)34-18-30-14-26-16-32-26/h1-2,4-5,7-13,26-27H,14-19H2 |
| InChIKey | HKZRURJTRPGRJC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 61.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|