C23H24FNO3 — CID 59790919
2-fluoro-4-[4-[4-(oxiran-2-ylmethoxymethoxy)cyclohexyl]phenyl]benzonitrile (PubChem CID 59790919) has the molecular formula C23H24FNO3 and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-fluoro-4-[4-[4-(oxiran-2-ylmethoxymethoxy)cyclohexyl]phenyl]benzonitrile.
| Compound Name | 2-fluoro-4-[4-[4-(oxiran-2-ylmethoxymethoxy)cyclohexyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 59790919 |
| Molecular Formula | C23H24FNO3 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-fluoro-4-[4-[4-(oxiran-2-ylmethoxymethoxy)cyclohexyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(C3CCC(OCOCC4CO4)CC3)cc2)cc1F |
| InChI | InChI=1S/C23H24FNO3/c24-23-11-19(5-6-20(23)12-25)18-3-1-16(2-4-18)17-7-9-21(10-8-17)28-15-26-13-22-14-27-22/h1-6,11,17,21-22H,7-10,13-15H2 |
| InChIKey | TULPRBGTNAVMBP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|