C15H19FO2 — CID 59790559
2-[[4-(4-fluorophenyl)cyclohexyl]oxymethyl]oxirane (PubChem CID 59790559) has the molecular formula C15H19FO2 and a molecular weight of 250.31 g/mol. Its IUPAC name is 2-[[4-(4-fluorophenyl)cyclohexyl]oxymethyl]oxirane.
| Compound Name | 2-[[4-(4-fluorophenyl)cyclohexyl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 59790559 |
| Molecular Formula | C15H19FO2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 2-[[4-(4-fluorophenyl)cyclohexyl]oxymethyl]oxirane |
| SMILES | Fc1ccc(C2CCC(OCC3CO3)CC2)cc1 |
| InChI | InChI=1S/C15H19FO2/c16-13-5-1-11(2-6-13)12-3-7-14(8-4-12)17-9-15-10-18-15/h1-2,5-6,12,14-15H,3-4,7-10H2 |
| InChIKey | ZCGMCMROCDBIHN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|