C16H21ClO3 — CID 59791027
2-[[4-(4-chlorophenyl)cyclohexyl]oxymethoxymethyl]oxirane (PubChem CID 59791027) has the molecular formula C16H21ClO3 and a molecular weight of 296.79 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)cyclohexyl]oxymethoxymethyl]oxirane.
| Compound Name | 2-[[4-(4-chlorophenyl)cyclohexyl]oxymethoxymethyl]oxirane |
|---|---|
| PubChem CID | 59791027 |
| Molecular Formula | C16H21ClO3 |
| Molecular Weight | 296.79 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)cyclohexyl]oxymethoxymethyl]oxirane |
| SMILES | Clc1ccc(C2CCC(OCOCC3CO3)CC2)cc1 |
| InChI | InChI=1S/C16H21ClO3/c17-14-5-1-12(2-6-14)13-3-7-15(8-4-13)20-11-18-9-16-10-19-16/h1-2,5-6,13,15-16H,3-4,7-11H2 |
| InChIKey | UUBFYGOEHWUZBG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.79 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|