C28H40O10 — CID 59791083
[4-[[4-(oxiran-2-ylmethoxymethoxy)cyclohexyl]oxymethoxy]phenyl] 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate (PubChem CID 59791083) has the molecular formula C28H40O10 and a molecular weight of 536.62 g/mol. Its IUPAC name is [4-[[4-(oxiran-2-ylmethoxymethoxy)cyclohexyl]oxymethoxy]phenyl] 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate.
| Compound Name | [4-[[4-(oxiran-2-ylmethoxymethoxy)cyclohexyl]oxymethoxy]phenyl] 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59791083 |
| Molecular Formula | C28H40O10 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | [4-[[4-(oxiran-2-ylmethoxymethoxy)cyclohexyl]oxymethoxy]phenyl] 4-(oxiran-2-ylmethoxymethoxy)cyclohexane-1-carboxylate |
| SMILES | O=C(Oc1ccc(OCOC2CCC(OCOCC3CO3)CC2)cc1)C1CCC(OCOCC2CO2)CC1 |
| InChI | InChI=1S/C28H40O10/c29-28(20-1-3-21(4-2-20)34-17-30-13-26-15-32-26)38-25-11-9-24(10-12-25)37-19-36-23-7-5-22(6-8-23)35-18-31-14-27-16-33-27/h9-12,20-23,26-27H,1-8,13-19H2 |
| InChIKey | LSNPPMQSXPBTFP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 106.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|