C23H32ClNO3 — CID 154858939
[4-(4-chlorophenyl)piperidin-1-yl]-[4-(oxolan-2-ylmethoxy)cyclohexyl]methanone (PubChem CID 154858939) has the molecular formula C23H32ClNO3 and a molecular weight of 405.97 g/mol. Its IUPAC name is [4-(4-chlorophenyl)piperidin-1-yl]-[4-(oxolan-2-ylmethoxy)cyclohexyl]methanone.
| Compound Name | [4-(4-chlorophenyl)piperidin-1-yl]-[4-(oxolan-2-ylmethoxy)cyclohexyl]methanone |
|---|---|
| PubChem CID | 154858939 |
| Molecular Formula | C23H32ClNO3 |
| Molecular Weight | 405.97 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | [4-(4-chlorophenyl)piperidin-1-yl]-[4-(oxolan-2-ylmethoxy)cyclohexyl]methanone |
| SMILES | O=C(C1CCC(OCC2CCCO2)CC1)N1CCC(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H32ClNO3/c24-20-7-3-17(4-8-20)18-11-13-25(14-12-18)23(26)19-5-9-21(10-6-19)28-16-22-2-1-15-27-22/h3-4,7-8,18-19,21-22H,1-2,5-6,9-16H2 |
| InChIKey | WNTVJQYMKLEBDB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.97 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |