C28H33F3O3 — CID 59790578
2-[[4-[4-[4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]cyclohexyl]oxymethoxymethyl]oxirane (PubChem CID 59790578) has the molecular formula C28H33F3O3 and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-[[4-[4-[4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]cyclohexyl]oxymethoxymethyl]oxirane.
| Compound Name | 2-[[4-[4-[4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]cyclohexyl]oxymethoxymethyl]oxirane |
|---|---|
| PubChem CID | 59790578 |
| Molecular Formula | C28H33F3O3 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 2-[[4-[4-[4-(3,4,5-trifluorophenyl)phenyl]cyclohexyl]cyclohexyl]oxymethoxymethyl]oxirane |
| SMILES | Fc1cc(-c2ccc(C3CCC(C4CCC(OCOCC5CO5)CC4)CC3)cc2)cc(F)c1F |
| InChI | InChI=1S/C28H33F3O3/c29-26-13-23(14-27(30)28(26)31)22-7-5-19(6-8-22)18-1-3-20(4-2-18)21-9-11-24(12-10-21)34-17-32-15-25-16-33-25/h5-8,13-14,18,20-21,24-25H,1-4,9-12,15-17H2 |
| InChIKey | LKXREKAVWZHFJK-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|