C56H66N2O3 — CID 91582864
4-[4-[4-[4-(oxiran-2-ylmethoxy)cyclohexyl]cyclohexyl]phenyl]benzonitrile;4-[4-[4-[4-(oxiran-2-ylmethyl)cyclohexyl]cyclohexyl]phenyl]benzonitrile (PubChem CID 91582864) has the molecular formula C56H66N2O3 and a molecular weight of 815.16 g/mol. Its IUPAC name is 4-[4-[4-[4-(oxiran-2-ylmethoxy)cyclohexyl]cyclohexyl]phenyl]benzonitrile;4-[4-[4-[4-(oxiran-2-ylmethyl)cyclohexyl]cyclohexyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[4-[4-(oxiran-2-ylmethoxy)cyclohexyl]cyclohexyl]phenyl]benzonitrile;4-[4-[4-[4-(oxiran-2-ylmethyl)cyclohexyl]cyclohexyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 91582864 |
| Molecular Formula | C56H66N2O3 |
| Molecular Weight | 815.16 g/mol |
| Exact Mass | 814.51 |
| IUPAC Name | 4-[4-[4-[4-(oxiran-2-ylmethoxy)cyclohexyl]cyclohexyl]phenyl]benzonitrile;4-[4-[4-[4-(oxiran-2-ylmethyl)cyclohexyl]cyclohexyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(C3CCC(C4CCC(CC5CO5)CC4)CC3)cc2)cc1.N#Cc1ccc(-c2ccc(C3CCC(C4CCC(OCC5CO5)CC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H33NO2.C28H33NO/c29-17-20-1-3-21(4-2-20)22-5-7-23(8-6-22)24-9-11-25(12-10-24)26-13-15-27(16-14-26)30-18-28-19-31-28;29-18-21-3-7-23(8-4-21)25-11-15-27(16-12-25)26-13-9-24(10-14-26)22-5-1-20(2-6-22)17-28-19-30-28/h1-8,24-28H,9-16,18-19H2;3-4,7-8,11-12,15-16,20,22,24,26,28H,1-2,5-6,9-10,13-14,17,19H2 |
| InChIKey | HCWKQJMVXYGEMF-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.16 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|