C30H25F7O10 — CID 59791115
[4-[[2-fluoro-4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]-2,3-bis(trifluoromethyl)phenyl] 4-(oxiran-2-ylmethoxymethoxy)benzoate (PubChem CID 59791115) has the molecular formula C30H25F7O10 and a molecular weight of 678.51 g/mol. Its IUPAC name is [4-[[2-fluoro-4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]-2,3-bis(trifluoromethyl)phenyl] 4-(oxiran-2-ylmethoxymethoxy)benzoate.
| Compound Name | [4-[[2-fluoro-4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]-2,3-bis(trifluoromethyl)phenyl] 4-(oxiran-2-ylmethoxymethoxy)benzoate |
|---|---|
| PubChem CID | 59791115 |
| Molecular Formula | C30H25F7O10 |
| Molecular Weight | 678.51 g/mol |
| Exact Mass | 678.13 |
| IUPAC Name | [4-[[2-fluoro-4-(oxiran-2-ylmethoxymethoxy)phenoxy]methoxy]-2,3-bis(trifluoromethyl)phenyl] 4-(oxiran-2-ylmethoxymethoxy)benzoate |
| SMILES | O=C(Oc1ccc(OCOc2ccc(OCOCC3CO3)cc2F)c(C(F)(F)F)c1C(F)(F)F)c1ccc(OCOCC2CO2)cc1 |
| InChI | InChI=1S/C30H25F7O10/c31-22-9-19(44-15-40-11-21-13-42-21)5-6-23(22)45-16-46-24-7-8-25(27(30(35,36)37)26(24)29(32,33)34)47-28(38)17-1-3-18(4-2-17)43-14-39-10-20-12-41-20/h1-9,20-21H,10-16H2 |
| InChIKey | QOUQGYMWSHUWKH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 106.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.51 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|