C27H26O6 — CID 59790544
[3-methyl-4-[[4-(oxiran-2-ylmethyl)phenoxy]methoxy]phenyl] 4-(oxiran-2-ylmethyl)benzoate (PubChem CID 59790544) has the molecular formula C27H26O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is [3-methyl-4-[[4-(oxiran-2-ylmethyl)phenoxy]methoxy]phenyl] 4-(oxiran-2-ylmethyl)benzoate.
| Compound Name | [3-methyl-4-[[4-(oxiran-2-ylmethyl)phenoxy]methoxy]phenyl] 4-(oxiran-2-ylmethyl)benzoate |
|---|---|
| PubChem CID | 59790544 |
| Molecular Formula | C27H26O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | [3-methyl-4-[[4-(oxiran-2-ylmethyl)phenoxy]methoxy]phenyl] 4-(oxiran-2-ylmethyl)benzoate |
| SMILES | Cc1cc(OC(=O)c2ccc(CC3CO3)cc2)ccc1OCOc1ccc(CC2CO2)cc1 |
| InChI | InChI=1S/C27H26O6/c1-18-12-23(33-27(28)21-6-2-19(3-7-21)13-24-15-29-24)10-11-26(18)32-17-31-22-8-4-20(5-9-22)14-25-16-30-25/h2-12,24-25H,13-17H2,1H3 |
| InChIKey | DTWAFDYSCRKWHJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 69.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|