C32H34O10 — CID 59755195
[3-methyl-4-[[4-(3-prop-2-enoyloxypropoxy)phenoxy]methoxy]phenyl] 4-(3-ethenylperoxypropoxy)benzoate (PubChem CID 59755195) has the molecular formula C32H34O10 and a molecular weight of 578.61 g/mol. Its IUPAC name is [3-methyl-4-[[4-(3-prop-2-enoyloxypropoxy)phenoxy]methoxy]phenyl] 4-(3-ethenylperoxypropoxy)benzoate.
| Compound Name | [3-methyl-4-[[4-(3-prop-2-enoyloxypropoxy)phenoxy]methoxy]phenyl] 4-(3-ethenylperoxypropoxy)benzoate |
|---|---|
| PubChem CID | 59755195 |
| Molecular Formula | C32H34O10 |
| Molecular Weight | 578.61 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | [3-methyl-4-[[4-(3-prop-2-enoyloxypropoxy)phenoxy]methoxy]phenyl] 4-(3-ethenylperoxypropoxy)benzoate |
| SMILES | C=COOCCCOc1ccc(C(=O)Oc2ccc(OCOc3ccc(OCCCOC(=O)C=C)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C32H34O10/c1-4-31(33)37-20-6-18-35-27-12-14-28(15-13-27)38-23-39-30-17-16-29(22-24(30)3)42-32(34)25-8-10-26(11-9-25)36-19-7-21-41-40-5-2/h4-5,8-17,22H,1-2,6-7,18-21,23H2,3H3 |
| InChIKey | FHRRLVSRYSQBOB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.61 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|