C26H21F3O8 — CID 59790530
[3-fluoro-4-[[2-fluoro-4-(oxiran-2-ylmethoxy)phenoxy]methoxy]phenyl] 2-fluoro-4-(oxiran-2-ylmethoxy)benzoate (PubChem CID 59790530) has the molecular formula C26H21F3O8 and a molecular weight of 518.44 g/mol. Its IUPAC name is [3-fluoro-4-[[2-fluoro-4-(oxiran-2-ylmethoxy)phenoxy]methoxy]phenyl] 2-fluoro-4-(oxiran-2-ylmethoxy)benzoate.
| Compound Name | [3-fluoro-4-[[2-fluoro-4-(oxiran-2-ylmethoxy)phenoxy]methoxy]phenyl] 2-fluoro-4-(oxiran-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 59790530 |
| Molecular Formula | C26H21F3O8 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | [3-fluoro-4-[[2-fluoro-4-(oxiran-2-ylmethoxy)phenoxy]methoxy]phenyl] 2-fluoro-4-(oxiran-2-ylmethoxy)benzoate |
| SMILES | O=C(Oc1ccc(OCOc2ccc(OCC3CO3)cc2F)c(F)c1)c1ccc(OCC2CO2)cc1F |
| InChI | InChI=1S/C26H21F3O8/c27-21-7-15(31-10-18-12-33-18)1-4-20(21)26(30)37-17-3-6-25(23(29)9-17)36-14-35-24-5-2-16(8-22(24)28)32-11-19-13-34-19/h1-9,18-19H,10-14H2 |
| InChIKey | CAADVLVCCYXCIY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|