C38H34F2O10 — CID 89072714
[7-[2-fluoro-4-[1-(oxiran-2-ylmethoxy)ethoxy]benzoyl]oxy-9-methyl-9H-fluoren-2-yl] 2-fluoro-4-[1-(oxiran-2-ylmethoxy)ethoxy]benzoate (PubChem CID 89072714) has the molecular formula C38H34F2O10 and a molecular weight of 688.68 g/mol. Its IUPAC name is [7-[2-fluoro-4-[1-(oxiran-2-ylmethoxy)ethoxy]benzoyl]oxy-9-methyl-9H-fluoren-2-yl] 2-fluoro-4-[1-(oxiran-2-ylmethoxy)ethoxy]benzoate.
| Compound Name | [7-[2-fluoro-4-[1-(oxiran-2-ylmethoxy)ethoxy]benzoyl]oxy-9-methyl-9H-fluoren-2-yl] 2-fluoro-4-[1-(oxiran-2-ylmethoxy)ethoxy]benzoate |
|---|---|
| PubChem CID | 89072714 |
| Molecular Formula | C38H34F2O10 |
| Molecular Weight | 688.68 g/mol |
| Exact Mass | 688.21 |
| IUPAC Name | [7-[2-fluoro-4-[1-(oxiran-2-ylmethoxy)ethoxy]benzoyl]oxy-9-methyl-9H-fluoren-2-yl] 2-fluoro-4-[1-(oxiran-2-ylmethoxy)ethoxy]benzoate |
| SMILES | CC(OCC1CO1)Oc1ccc(C(=O)Oc2ccc3c(c2)C(C)c2cc(OC(=O)c4ccc(OC(C)OCC5CO5)cc4F)ccc2-3)c(F)c1 |
| InChI | InChI=1S/C38H34F2O10/c1-20-33-12-23(49-37(41)31-10-6-25(14-35(31)39)47-21(2)43-16-27-18-45-27)4-8-29(33)30-9-5-24(13-34(20)30)50-38(42)32-11-7-26(15-36(32)40)48-22(3)44-17-28-19-46-28/h4-15,20-22,27-28H,16-19H2,1-3H3 |
| InChIKey | KIOIIAAPIJESBJ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.68 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|