C42H45FO10 — CID 21044886
[9-methyl-7-[[4-[4-(oxiran-2-ylmethoxy)butoxy]phenyl]methylperoxy]-9H-fluoren-2-yl] 3-fluoro-4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate (PubChem CID 21044886) has the molecular formula C42H45FO10 and a molecular weight of 728.81 g/mol. Its IUPAC name is [9-methyl-7-[[4-[4-(oxiran-2-ylmethoxy)butoxy]phenyl]methylperoxy]-9H-fluoren-2-yl] 3-fluoro-4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate.
| Compound Name | [9-methyl-7-[[4-[4-(oxiran-2-ylmethoxy)butoxy]phenyl]methylperoxy]-9H-fluoren-2-yl] 3-fluoro-4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate |
|---|---|
| PubChem CID | 21044886 |
| Molecular Formula | C42H45FO10 |
| Molecular Weight | 728.81 g/mol |
| Exact Mass | 728.30 |
| IUPAC Name | [9-methyl-7-[[4-[4-(oxiran-2-ylmethoxy)butoxy]phenyl]methylperoxy]-9H-fluoren-2-yl] 3-fluoro-4-[4-(oxiran-2-ylmethoxy)butoxy]benzoate |
| SMILES | CC1c2cc(OOCc3ccc(OCCCCOCC4CO4)cc3)ccc2-c2ccc(OC(=O)c3ccc(OCCCCOCC4CO4)c(F)c3)cc21 |
| InChI | InChI=1S/C42H45FO10/c1-28-38-21-32(52-42(44)30-8-15-41(40(43)20-30)48-19-5-3-17-46-25-35-27-50-35)11-13-36(38)37-14-12-33(22-39(28)37)53-51-23-29-6-9-31(10-7-29)47-18-4-2-16-45-24-34-26-49-34/h6-15,20-22,28,34-35H,2-5,16-19,23-27H2,1H3 |
| InChIKey | QMWZTQWQMGLUCE-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 106.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.81 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|