C38H39NO3 — CID 58586900
2-[4-[4-[2-[7-[2-(4-isocyanophenyl)ethyl]-9-methyl-9H-fluoren-2-yl]ethyl]phenoxy]butoxymethyl]oxirane (PubChem CID 58586900) has the molecular formula C38H39NO3 and a molecular weight of 557.73 g/mol. Its IUPAC name is 2-[4-[4-[2-[7-[2-(4-isocyanophenyl)ethyl]-9-methyl-9H-fluoren-2-yl]ethyl]phenoxy]butoxymethyl]oxirane.
| Compound Name | 2-[4-[4-[2-[7-[2-(4-isocyanophenyl)ethyl]-9-methyl-9H-fluoren-2-yl]ethyl]phenoxy]butoxymethyl]oxirane |
|---|---|
| PubChem CID | 58586900 |
| Molecular Formula | C38H39NO3 |
| Molecular Weight | 557.73 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | 2-[4-[4-[2-[7-[2-(4-isocyanophenyl)ethyl]-9-methyl-9H-fluoren-2-yl]ethyl]phenoxy]butoxymethyl]oxirane |
| SMILES | [C-]#[N+]c1ccc(CCc2ccc3c(c2)C(C)c2cc(CCc4ccc(OCCCCOCC5CO5)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C38H39NO3/c1-27-37-23-30(7-5-28-9-15-32(39-2)16-10-28)13-19-35(37)36-20-14-31(24-38(27)36)8-6-29-11-17-33(18-12-29)41-22-4-3-21-40-25-34-26-42-34/h9-20,23-24,27,34H,3-8,21-22,25-26H2,1H3 |
| InChIKey | BCPXSCQWACEXFC-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 35.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.73 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|