C36H34N2O5 — CID 161198739
2-[4-[4-(4-isocyanophenyl)phenoxy]butoxymethyl]oxirane;2-[[4-(4-isocyanophenyl)phenoxy]methyl]oxirane (PubChem CID 161198739) has the molecular formula C36H34N2O5 and a molecular weight of 574.68 g/mol. Its IUPAC name is 2-[4-[4-(4-isocyanophenyl)phenoxy]butoxymethyl]oxirane;2-[[4-(4-isocyanophenyl)phenoxy]methyl]oxirane.
| Compound Name | 2-[4-[4-(4-isocyanophenyl)phenoxy]butoxymethyl]oxirane;2-[[4-(4-isocyanophenyl)phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 161198739 |
| Molecular Formula | C36H34N2O5 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 2-[4-[4-(4-isocyanophenyl)phenoxy]butoxymethyl]oxirane;2-[[4-(4-isocyanophenyl)phenoxy]methyl]oxirane |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(OCC3CO3)cc2)cc1.[C-]#[N+]c1ccc(-c2ccc(OCCCCOCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C20H21NO3.C16H13NO2/c1-21-18-8-4-16(5-9-18)17-6-10-19(11-7-17)23-13-3-2-12-22-14-20-15-24-20;1-17-14-6-2-12(3-7-14)13-4-8-15(9-5-13)18-10-16-11-19-16/h4-11,20H,2-3,12-15H2;2-9,16H,10-11H2 |
| InChIKey | UURUHJAOSGUZSQ-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 61.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|