C42H47NO3 — CID 58586815
3-[6-[4-[2-[7-[2-(4-isocyanophenyl)ethyl]-9-methyl-9H-fluoren-2-yl]ethyl]phenoxy]hexoxymethyl]-3-methyloxetane (PubChem CID 58586815) has the molecular formula C42H47NO3 and a molecular weight of 613.84 g/mol. Its IUPAC name is 3-[6-[4-[2-[7-[2-(4-isocyanophenyl)ethyl]-9-methyl-9H-fluoren-2-yl]ethyl]phenoxy]hexoxymethyl]-3-methyloxetane.
| Compound Name | 3-[6-[4-[2-[7-[2-(4-isocyanophenyl)ethyl]-9-methyl-9H-fluoren-2-yl]ethyl]phenoxy]hexoxymethyl]-3-methyloxetane |
|---|---|
| PubChem CID | 58586815 |
| Molecular Formula | C42H47NO3 |
| Molecular Weight | 613.84 g/mol |
| Exact Mass | 613.36 |
| IUPAC Name | 3-[6-[4-[2-[7-[2-(4-isocyanophenyl)ethyl]-9-methyl-9H-fluoren-2-yl]ethyl]phenoxy]hexoxymethyl]-3-methyloxetane |
| SMILES | [C-]#[N+]c1ccc(CCc2ccc3c(c2)C(C)c2cc(CCc4ccc(OCCCCCCOCC5(C)COC5)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C42H47NO3/c1-31-40-26-34(10-8-32-12-18-36(43-3)19-13-32)16-22-38(40)39-23-17-35(27-41(31)39)11-9-33-14-20-37(21-15-33)46-25-7-5-4-6-24-44-28-42(2)29-45-30-42/h12-23,26-27,31H,4-11,24-25,28-30H2,1-2H3 |
| InChIKey | GOMUIWQUQICASM-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 32.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.84 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|