C34H39NO4 — CID 58586829
3-ethyl-3-[6-[4-[(7-isocyano-9-methyl-9H-fluoren-2-yl)methoxy]phenoxy]hexoxymethyl]oxetane (PubChem CID 58586829) has the molecular formula C34H39NO4 and a molecular weight of 525.69 g/mol. Its IUPAC name is 3-ethyl-3-[6-[4-[(7-isocyano-9-methyl-9H-fluoren-2-yl)methoxy]phenoxy]hexoxymethyl]oxetane.
| Compound Name | 3-ethyl-3-[6-[4-[(7-isocyano-9-methyl-9H-fluoren-2-yl)methoxy]phenoxy]hexoxymethyl]oxetane |
|---|---|
| PubChem CID | 58586829 |
| Molecular Formula | C34H39NO4 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | 3-ethyl-3-[6-[4-[(7-isocyano-9-methyl-9H-fluoren-2-yl)methoxy]phenoxy]hexoxymethyl]oxetane |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(C)c1cc(COc3ccc(OCCCCCCOCC4(CC)COC4)cc3)ccc1-2 |
| InChI | InChI=1S/C34H39NO4/c1-4-34(23-37-24-34)22-36-17-7-5-6-8-18-38-28-11-13-29(14-12-28)39-21-26-9-15-30-31-16-10-27(35-3)20-33(31)25(2)32(30)19-26/h9-16,19-20,25H,4-8,17-18,21-24H2,1-2H3 |
| InChIKey | XNMJUKHQHPOJKJ-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 41.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|