C41H47FO5 — CID 58586946
3-ethyl-3-[4-[4-[[7-[(3-fluoro-4-propylphenyl)methoxy]-9-methyl-9H-fluoren-2-yl]oxymethyl]phenoxy]butoxymethyl]oxetane (PubChem CID 58586946) has the molecular formula C41H47FO5 and a molecular weight of 638.82 g/mol. Its IUPAC name is 3-ethyl-3-[4-[4-[[7-[(3-fluoro-4-propylphenyl)methoxy]-9-methyl-9H-fluoren-2-yl]oxymethyl]phenoxy]butoxymethyl]oxetane.
| Compound Name | 3-ethyl-3-[4-[4-[[7-[(3-fluoro-4-propylphenyl)methoxy]-9-methyl-9H-fluoren-2-yl]oxymethyl]phenoxy]butoxymethyl]oxetane |
|---|---|
| PubChem CID | 58586946 |
| Molecular Formula | C41H47FO5 |
| Molecular Weight | 638.82 g/mol |
| Exact Mass | 638.34 |
| IUPAC Name | 3-ethyl-3-[4-[4-[[7-[(3-fluoro-4-propylphenyl)methoxy]-9-methyl-9H-fluoren-2-yl]oxymethyl]phenoxy]butoxymethyl]oxetane |
| SMILES | CCCc1ccc(COc2ccc3c(c2)C(C)c2cc(OCc4ccc(OCCCCOCC5(CC)COC5)cc4)ccc2-3)cc1F |
| InChI | InChI=1S/C41H47FO5/c1-4-8-32-12-9-31(21-40(32)42)25-47-35-16-18-37-36-17-15-34(22-38(36)29(3)39(37)23-35)46-24-30-10-13-33(14-11-30)45-20-7-6-19-43-26-41(5-2)27-44-28-41/h9-18,21-23,29H,4-8,19-20,24-28H2,1-3H3 |
| InChIKey | BJSBVAJNQCIFPS-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.82 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|