C40H46O3 — CID 89267632
2-[4-[4-[1-[9-methyl-7-[1-(4-propylphenyl)ethyl]-9H-fluoren-2-yl]ethyl]phenoxy]butoxymethyl]oxirane (PubChem CID 89267632) has the molecular formula C40H46O3 and a molecular weight of 574.81 g/mol. Its IUPAC name is 2-[4-[4-[1-[9-methyl-7-[1-(4-propylphenyl)ethyl]-9H-fluoren-2-yl]ethyl]phenoxy]butoxymethyl]oxirane.
| Compound Name | 2-[4-[4-[1-[9-methyl-7-[1-(4-propylphenyl)ethyl]-9H-fluoren-2-yl]ethyl]phenoxy]butoxymethyl]oxirane |
|---|---|
| PubChem CID | 89267632 |
| Molecular Formula | C40H46O3 |
| Molecular Weight | 574.81 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | 2-[4-[4-[1-[9-methyl-7-[1-(4-propylphenyl)ethyl]-9H-fluoren-2-yl]ethyl]phenoxy]butoxymethyl]oxirane |
| SMILES | CCCc1ccc(C(C)c2ccc3c(c2)C(C)c2cc(C(C)c4ccc(OCCCCOCC5CO5)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C40H46O3/c1-5-8-30-9-11-31(12-10-30)27(2)33-15-19-37-38-20-16-34(24-40(38)29(4)39(37)23-33)28(3)32-13-17-35(18-14-32)42-22-7-6-21-41-25-36-26-43-36/h9-20,23-24,27-29,36H,5-8,21-22,25-26H2,1-4H3 |
| InChIKey | GQGIACQCFFAOBN-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.81 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|