C39H40O8 — CID 21044879
[9-methyl-7-[[4-[(3-methyloxetan-3-yl)methoxy]phenyl]methylperoxy]-9H-fluoren-2-yl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate (PubChem CID 21044879) has the molecular formula C39H40O8 and a molecular weight of 636.74 g/mol. Its IUPAC name is [9-methyl-7-[[4-[(3-methyloxetan-3-yl)methoxy]phenyl]methylperoxy]-9H-fluoren-2-yl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate.
| Compound Name | [9-methyl-7-[[4-[(3-methyloxetan-3-yl)methoxy]phenyl]methylperoxy]-9H-fluoren-2-yl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate |
|---|---|
| PubChem CID | 21044879 |
| Molecular Formula | C39H40O8 |
| Molecular Weight | 636.74 g/mol |
| Exact Mass | 636.27 |
| IUPAC Name | [9-methyl-7-[[4-[(3-methyloxetan-3-yl)methoxy]phenyl]methylperoxy]-9H-fluoren-2-yl] 4-[(3-ethyloxetan-3-yl)methoxy]benzoate |
| SMILES | CCC1(COc2ccc(C(=O)Oc3ccc4c(c3)C(C)c3cc(OOCc5ccc(OCC6(C)COC6)cc5)ccc3-4)cc2)COC1 |
| InChI | InChI=1S/C39H40O8/c1-4-39(23-42-24-39)25-44-30-11-7-28(8-12-30)37(40)46-31-13-15-33-34-16-14-32(18-36(34)26(2)35(33)17-31)47-45-19-27-5-9-29(10-6-27)43-22-38(3)20-41-21-38/h5-18,26H,4,19-25H2,1-3H3 |
| InChIKey | PVJOBZIETKIAGG-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.74 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|