C40H41ClO8 — CID 21044894
[9-methyl-7-[[4-[5-(oxiran-2-yl)pentoxy]phenyl]methylperoxy]-9H-fluoren-2-yl] 3-chloro-4-[3-(oxiran-2-yl)propoxy]benzoate (PubChem CID 21044894) has the molecular formula C40H41ClO8 and a molecular weight of 685.21 g/mol. Its IUPAC name is [9-methyl-7-[[4-[5-(oxiran-2-yl)pentoxy]phenyl]methylperoxy]-9H-fluoren-2-yl] 3-chloro-4-[3-(oxiran-2-yl)propoxy]benzoate.
| Compound Name | [9-methyl-7-[[4-[5-(oxiran-2-yl)pentoxy]phenyl]methylperoxy]-9H-fluoren-2-yl] 3-chloro-4-[3-(oxiran-2-yl)propoxy]benzoate |
|---|---|
| PubChem CID | 21044894 |
| Molecular Formula | C40H41ClO8 |
| Molecular Weight | 685.21 g/mol |
| Exact Mass | 684.25 |
| IUPAC Name | [9-methyl-7-[[4-[5-(oxiran-2-yl)pentoxy]phenyl]methylperoxy]-9H-fluoren-2-yl] 3-chloro-4-[3-(oxiran-2-yl)propoxy]benzoate |
| SMILES | CC1c2cc(OOCc3ccc(OCCCCCC4CO4)cc3)ccc2-c2ccc(OC(=O)c3ccc(OCCCC4CO4)c(Cl)c3)cc21 |
| InChI | InChI=1S/C40H41ClO8/c1-26-36-21-30(48-40(42)28-10-17-39(38(41)20-28)44-19-5-7-33-25-46-33)13-15-34(36)35-16-14-31(22-37(26)35)49-47-23-27-8-11-29(12-9-27)43-18-4-2-3-6-32-24-45-32/h8-17,20-22,26,32-33H,2-7,18-19,23-25H2,1H3 |
| InChIKey | GAQGMTSTTKRKJW-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 88.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.21 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|