C50H56F2O10 — CID 88957940
[7-[2-fluoro-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxy-9-methyl-9H-fluoren-2-yl] 2-fluoro-4-[1-[(4-hydroxycyclohexyl)methoxy]butoxy]benzoate (PubChem CID 88957940) has the molecular formula C50H56F2O10 and a molecular weight of 854.98 g/mol. Its IUPAC name is [7-[2-fluoro-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxy-9-methyl-9H-fluoren-2-yl] 2-fluoro-4-[1-[(4-hydroxycyclohexyl)methoxy]butoxy]benzoate.
| Compound Name | [7-[2-fluoro-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxy-9-methyl-9H-fluoren-2-yl] 2-fluoro-4-[1-[(4-hydroxycyclohexyl)methoxy]butoxy]benzoate |
|---|---|
| PubChem CID | 88957940 |
| Molecular Formula | C50H56F2O10 |
| Molecular Weight | 854.98 g/mol |
| Exact Mass | 854.38 |
| IUPAC Name | [7-[2-fluoro-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoyl]oxy-9-methyl-9H-fluoren-2-yl] 2-fluoro-4-[1-[(4-hydroxycyclohexyl)methoxy]butoxy]benzoate |
| SMILES | CCCC(OCC1CCC(O)CC1)Oc1ccc(C(=O)Oc2ccc3c(c2)C(C)c2cc(OC(=O)c4ccc(OC(CCC)OCC5CCC6OC6C5)cc4F)ccc2-3)c(F)c1 |
| InChI | InChI=1S/C50H56F2O10/c1-4-6-47(56-27-30-8-11-32(53)12-9-30)58-35-15-19-39(43(51)25-35)49(54)60-33-13-17-37-38-18-14-34(24-42(38)29(3)41(37)23-33)61-50(55)40-20-16-36(26-44(40)52)59-48(7-5-2)57-28-31-10-21-45-46(22-31)62-45/h13-20,23-26,29-32,45-48,53H,4-12,21-22,27-28H2,1-3H3 |
| InChIKey | WBTDEXRTAJXATO-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.98 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|