C37H40F2O9 — CID 88957938
[4-[4-(1-ethenoxybutoxy)-2-fluorobenzoyl]oxyphenyl] 2-fluoro-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate (PubChem CID 88957938) has the molecular formula C37H40F2O9 and a molecular weight of 666.71 g/mol. Its IUPAC name is [4-[4-(1-ethenoxybutoxy)-2-fluorobenzoyl]oxyphenyl] 2-fluoro-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate.
| Compound Name | [4-[4-(1-ethenoxybutoxy)-2-fluorobenzoyl]oxyphenyl] 2-fluoro-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate |
|---|---|
| PubChem CID | 88957938 |
| Molecular Formula | C37H40F2O9 |
| Molecular Weight | 666.71 g/mol |
| Exact Mass | 666.26 |
| IUPAC Name | [4-[4-(1-ethenoxybutoxy)-2-fluorobenzoyl]oxyphenyl] 2-fluoro-4-[1-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxy)butoxy]benzoate |
| SMILES | C=COC(CCC)Oc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OC(CCC)OCC4CCC5OC5C4)cc3F)cc2)c(F)c1 |
| InChI | InChI=1S/C37H40F2O9/c1-4-7-34(42-6-3)44-26-14-16-28(30(38)20-26)36(40)46-24-10-12-25(13-11-24)47-37(41)29-17-15-27(21-31(29)39)45-35(8-5-2)43-22-23-9-18-32-33(19-23)48-32/h6,10-17,20-21,23,32-35H,3-5,7-9,18-19,22H2,1-2H3 |
| InChIKey | WZVWNDLCZDKTNJ-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 102.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.71 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|